Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium phosphate, dibasic heptahydrate, 99+%, for analysis
CAS: 7782-85-6 Molecular Formula: H15Na2O11P Molecular Weight (g/mol): 268.06 MDL Number: MFCD00149180 InChI Key: LVXHNCUCBXIIPE-UHFFFAOYSA-L Synonym: sodium phosphate dibasic heptahydrate,unii-70wt22sf4b,sodium phosphate, dibasic, heptahydrate,sodium hydrogen phosphate heptahydrate,disodium hydrogen phosphate heptahydrate,axea paragraph signthornaae,2na.hpo4.7h2o,sodium hydrogenphosphate heptahydrate,sodium phosphate dibasic, acs,disodium hydrogenphosphate heptahydrate PubChem CID: 6096963 IUPAC Name: disodium phosphoric acid heptahydrate SMILES: O.[Na+].[Na+].OP([O-])([O-])=O
| PubChem CID | 6096963 |
|---|---|
| CAS | 7782-85-6 |
| Molecular Weight (g/mol) | 268.06 |
| MDL Number | MFCD00149180 |
| SMILES | O.[Na+].[Na+].OP([O-])([O-])=O |
| Synonym | sodium phosphate dibasic heptahydrate,unii-70wt22sf4b,sodium phosphate, dibasic, heptahydrate,sodium hydrogen phosphate heptahydrate,disodium hydrogen phosphate heptahydrate,axea paragraph signthornaae,2na.hpo4.7h2o,sodium hydrogenphosphate heptahydrate,sodium phosphate dibasic, acs,disodium hydrogenphosphate heptahydrate |
| IUPAC Name | disodium phosphoric acid heptahydrate |
| InChI Key | LVXHNCUCBXIIPE-UHFFFAOYSA-L |
| Molecular Formula | H15Na2O11P |
Calcium carbonate, ACS, 99.0% min
CAS: 471-34-1 Molecular Formula: CCaO3 Molecular Weight (g/mol): 100.09 MDL Number: MFCD00010906 InChI Key: VTYYLEPIZMXCLO-UHFFFAOYSA-L Synonym: calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama PubChem CID: 10112 ChEBI: CHEBI:3311 SMILES: [Ca++].[O-]C([O-])=O
| PubChem CID | 10112 |
|---|---|
| CAS | 471-34-1 |
| Molecular Weight (g/mol) | 100.09 |
| ChEBI | CHEBI:3311 |
| MDL Number | MFCD00010906 |
| SMILES | [Ca++].[O-]C([O-])=O |
| Synonym | calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama |
| InChI Key | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
| Molecular Formula | CCaO3 |
Sodium peroxydisulfate, 98%
CAS: 7775-27-1 Molecular Formula: Na2O8S2 Molecular Weight (g/mol): 238.092 MDL Number: MFCD00003501 InChI Key: CHQMHPLRPQMAMX-UHFFFAOYSA-L Synonym: sodium persulfate,sodium peroxydisulfate,sodium peroxodisulfate,peroxydisulfuric acid, disodium salt,disodium peroxodisulphate,sodium persulphate,unii-j49fyf16je,persulfate de sodium french,sodium peroxydisulphate,disodium sulfonatooxy sulfate PubChem CID: 62655 IUPAC Name: disodium;sulfonatooxy sulfate SMILES: [O-]S(=O)(=O)OOS(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 62655 |
|---|---|
| CAS | 7775-27-1 |
| Molecular Weight (g/mol) | 238.092 |
| MDL Number | MFCD00003501 |
| SMILES | [O-]S(=O)(=O)OOS(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | sodium persulfate,sodium peroxydisulfate,sodium peroxodisulfate,peroxydisulfuric acid, disodium salt,disodium peroxodisulphate,sodium persulphate,unii-j49fyf16je,persulfate de sodium french,sodium peroxydisulphate,disodium sulfonatooxy sulfate |
| IUPAC Name | disodium;sulfonatooxy sulfate |
| InChI Key | CHQMHPLRPQMAMX-UHFFFAOYSA-L |
| Molecular Formula | Na2O8S2 |
Silver Nitrate, in Isopropanol, Certified, 0.0100N ±0.0002N (0.01M), LabChem™
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC Name: silver(1+) nitrate SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
Tetrabutylammonium hydroxide, 1M solution in methanol, AcroSeal™
CAS: 2052-49-5 | C16H37NO | 259.48 g/mol
| Linear Formula | [CH3(CH2)3]4NOH |
|---|---|
| Molecular Weight (g/mol) | 259.48 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Density | 0.9100g/mL |
| PubChem CID | 2723671 |
| Formula Weight | 259.46 |
| Melting Point | -98.0°C |
| Boiling Point | 65.0°C |
| Color | Colorless to Yellow |
| Physical Form | Solution |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| Concentration or Composition (by Analyte or Components) | 0.95 to 1.1M |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00009425 |
| Health Hazard 2 | GHS H Statement Toxic if swallowed. Toxic in contact with skin. Toxic if inhaled. Causes severe skin burns and eye damage. Causes damage to organs. Highly flammable liquid and vapor. |
| Packaging | AcroSeal™ Glass Bottle |
| Solubility Information | Solubility in water: soluble |
| Flash Point | 12°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Refractive Index | 1.3775 |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium hydroxide |
| Molecular Formula | C16H37NO |
| EINECS Number | 218-147-6 |
| Specific Gravity | 0.91 |
Tetrachloroauric(III) acid trihydrate, ACS reagent
CAS: 16961-25-4 Molecular Formula: AuCl4H Molecular Weight (g/mol): 339.77 InChI Key: VDLSFRRYNGEBEJ-UHFFFAOYSA-K IUPAC Name: trichlorogold hydrochloride SMILES: Cl.Cl[Au](Cl)Cl
| CAS | 16961-25-4 |
|---|---|
| Molecular Weight (g/mol) | 339.77 |
| SMILES | Cl.Cl[Au](Cl)Cl |
| IUPAC Name | trichlorogold hydrochloride |
| InChI Key | VDLSFRRYNGEBEJ-UHFFFAOYSA-K |
| Molecular Formula | AuCl4H |
Sodium bisulfate monohydrate, 99%, for analysis
CAS: 10034-88-5 Molecular Formula: H3NaO5S Molecular Weight (g/mol): 138.07 MDL Number: MFCD00149210 InChI Key: JXHZRQHZVYDRGX-UHFFFAOYSA-M Synonym: sodium bisulfate monohydrate,sodium hydrogen sulfate monohydrate,unii-3kls9y77yj,sulfuric acid, monosodium salt, hydrate,3kls9y77yj,sodium hydrogensulfate hydrate,sulfuric acid, monosodium salt, monohydrate,sodium hydrate hydrogen sulfate,sodium hydrogen sulfate-1-hydrate,acmc-20ajox PubChem CID: 23673662 SMILES: O.[Na+].OS([O-])(=O)=O
| PubChem CID | 23673662 |
|---|---|
| CAS | 10034-88-5 |
| Molecular Weight (g/mol) | 138.07 |
| MDL Number | MFCD00149210 |
| SMILES | O.[Na+].OS([O-])(=O)=O |
| Synonym | sodium bisulfate monohydrate,sodium hydrogen sulfate monohydrate,unii-3kls9y77yj,sulfuric acid, monosodium salt, hydrate,3kls9y77yj,sodium hydrogensulfate hydrate,sulfuric acid, monosodium salt, monohydrate,sodium hydrate hydrogen sulfate,sodium hydrogen sulfate-1-hydrate,acmc-20ajox |
| InChI Key | JXHZRQHZVYDRGX-UHFFFAOYSA-M |
| Molecular Formula | H3NaO5S |
Aluminum oxide, for chromatography, neutral, Brockmann I, 40-300 μm, 60A
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Sodium Hexametaphosphate, Thermo Scientific Chemicals
CAS: 68915-31-1 Molecular Formula: H2Na2O7P2 Molecular Weight (g/mol): 221.94 MDL Number: MFCD00136045 InChI Key: GYQBBRRVRKFJRG-UHFFFAOYSA-L IUPAC Name: disodium hydrogen (hydrogen phosphonatooxy)phosphonate SMILES: [Na+].[Na+].OP([O-])(=O)OP(O)([O-])=O
| CAS | 68915-31-1 |
|---|---|
| Molecular Weight (g/mol) | 221.94 |
| MDL Number | MFCD00136045 |
| SMILES | [Na+].[Na+].OP([O-])(=O)OP(O)([O-])=O |
| IUPAC Name | disodium hydrogen (hydrogen phosphonatooxy)phosphonate |
| InChI Key | GYQBBRRVRKFJRG-UHFFFAOYSA-L |
| Molecular Formula | H2Na2O7P2 |
Manganese Chloride, Tetrahydrate, MP Biomedicals
CAS: 13446-34-9 Molecular Formula: Cl2H8MnO4 Molecular Weight (g/mol): 197.90 MDL Number: MFCD00149792 InChI Key: CNFDGXZLMLFIJV-UHFFFAOYSA-L IUPAC Name: manganese(2+) tetrahydrate dichloride SMILES: O.O.O.O.[Cl-].[Cl-].[Mn++]
| CAS | 13446-34-9 |
|---|---|
| Molecular Weight (g/mol) | 197.90 |
| MDL Number | MFCD00149792 |
| SMILES | O.O.O.O.[Cl-].[Cl-].[Mn++] |
| IUPAC Name | manganese(2+) tetrahydrate dichloride |
| InChI Key | CNFDGXZLMLFIJV-UHFFFAOYSA-L |
| Molecular Formula | Cl2H8MnO4 |
Lithium hydroxide, anhydrous, 98%
CAS: 1310-65-2 Molecular Formula: HLiO Molecular Weight (g/mol): 23.95 MDL Number: MFCD00011095 InChI Key: WMFOQBRAJBCJND-UHFFFAOYSA-M Synonym: lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous PubChem CID: 3939 ChEBI: CHEBI:33979 SMILES: [Li+].[OH-]
| PubChem CID | 3939 |
|---|---|
| CAS | 1310-65-2 |
| Molecular Weight (g/mol) | 23.95 |
| ChEBI | CHEBI:33979 |
| MDL Number | MFCD00011095 |
| SMILES | [Li+].[OH-] |
| Synonym | lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous |
| InChI Key | WMFOQBRAJBCJND-UHFFFAOYSA-M |
| Molecular Formula | HLiO |
Tin(II) chloride dihydrate, low in Mercury, suitable for AAS
CAS: 10025-69-1 Molecular Formula: Cl2Sn·2H2O Molecular Weight (g/mol): 225.63 Synonym: Stannous chloride dihydrate
| CAS | 10025-69-1 |
|---|---|
| Molecular Weight (g/mol) | 225.63 |
| Synonym | Stannous chloride dihydrate |
| Molecular Formula | Cl2Sn·2H2O |
Potassium ferrocyanide trihydrate, 99+%, for analysis
CAS: 14459-95-1 Molecular Formula: C6H6FeK4N6O3 Molecular Weight (g/mol): 422.39 MDL Number: MFCD00167023 InChI Key: NLYKFUFIUWPPIZ-UHFFFAOYSA-N Synonym: Potassium hexacyanoferrate(II) IUPAC Name: tetrapotassium hexacyanoironbis(ylium) trihydrate SMILES: O.O.O.[K+].[K+].[K+].[K+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)C#N
| CAS | 14459-95-1 |
|---|---|
| Molecular Weight (g/mol) | 422.39 |
| MDL Number | MFCD00167023 |
| SMILES | O.O.O.[K+].[K+].[K+].[K+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)C#N |
| Synonym | Potassium hexacyanoferrate(II) |
| IUPAC Name | tetrapotassium hexacyanoironbis(ylium) trihydrate |
| InChI Key | NLYKFUFIUWPPIZ-UHFFFAOYSA-N |
| Molecular Formula | C6H6FeK4N6O3 |
Manganese(III) oxide, 98%
CAS: 1317-34-6 Molecular Formula: Mn2O3 Molecular Weight (g/mol): 157.873 MDL Number: MFCD00016217 InChI Key: GEYXPJBPASPPLI-UHFFFAOYSA-N Synonym: manganese iii oxide,manganic oxide,dimanganese trioxide,manganese sesquioxide,manganese trioxide,manganese manganate,manganese sisquioxide,manganese 3+ oxide,manganese oxide,oxo oxomanganiooxy manganese PubChem CID: 14824 IUPAC Name: oxo(oxomanganiooxy)manganese SMILES: O=[Mn]O[Mn]=O
| PubChem CID | 14824 |
|---|---|
| CAS | 1317-34-6 |
| Molecular Weight (g/mol) | 157.873 |
| MDL Number | MFCD00016217 |
| SMILES | O=[Mn]O[Mn]=O |
| Synonym | manganese iii oxide,manganic oxide,dimanganese trioxide,manganese sesquioxide,manganese trioxide,manganese manganate,manganese sisquioxide,manganese 3+ oxide,manganese oxide,oxo oxomanganiooxy manganese |
| IUPAC Name | oxo(oxomanganiooxy)manganese |
| InChI Key | GEYXPJBPASPPLI-UHFFFAOYSA-N |
| Molecular Formula | Mn2O3 |
Lead(II) nitrate, 99+%
CAS: 10099-74-8 Molecular Formula: N2O6Pb Molecular Weight (g/mol): 331.20 MDL Number: MFCD00011153 InChI Key: RLJMLMKIBZAXJO-UHFFFAOYSA-N Synonym: lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt PubChem CID: 24924 ChEBI: CHEBI:37187 SMILES: [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24924 |
|---|---|
| CAS | 10099-74-8 |
| Molecular Weight (g/mol) | 331.20 |
| ChEBI | CHEBI:37187 |
| MDL Number | MFCD00011153 |
| SMILES | [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt |
| InChI Key | RLJMLMKIBZAXJO-UHFFFAOYSA-N |
| Molecular Formula | N2O6Pb |